Comparison between Glucose and Glycogen

By: Prof. Dr. Fazal Rehman Shamil | Last updated: February 3, 2024

Let me share with you a comparison between Glucose and Glycogen.

AspectGlucoseGlycogen
Basic formMonosaccharidePolysaccharide
CompositionC6H12O6(C6H10O5)n
StorageShort-term energy storage.Long-term energy storage
StructureSimple molecule.Highly branched structure.
FormationProduced during photosynthesis.Formed by the polymerization of glucose molecules.
LocationFound in the bloodstream.Found in liver and muscles.
FunctionPrimary energy source for cells.Energy storage (glycogenolysis releases glucose when needed).
SolubilityHighly soluble in water.Insoluble in water due to its large, complex structure.
DigestionAbsorbed directly into the bloodstream after digestion.Broken down into glucose through glycogenolysis during energy needs.
RegulationBlood glucose levels regulated by insulin and glucagon.Glycogen storage regulated by insulin and glucagon, impacting blood glucose levels.
DegradationConverted to ATP through cellular respiration.Broken down into glucose through glycogenolysis when energy is required.